C15H17N5O2 — CID 28737366
3,5-dimethyl-N-[3-(2H-tetrazol-5-yl)propyl]-1-benzofuran-2-carboxamide (PubChem CID 28737366) has the molecular formula C15H17N5O2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-(2H-tetrazol-5-yl)propyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3,5-dimethyl-N-[3-(2H-tetrazol-5-yl)propyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 28737366 |
| Molecular Formula | C15H17N5O2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3,5-dimethyl-N-[3-(2H-tetrazol-5-yl)propyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1ccc2oc(C(=O)NCCCc3nn[nH]n3)c(C)c2c1 |
| InChI | InChI=1S/C15H17N5O2/c1-9-5-6-12-11(8-9)10(2)14(22-12)15(21)16-7-3-4-13-17-19-20-18-13/h5-6,8H,3-4,7H2,1-2H3,(H,16,21)(H,17,18,19,20) |
| InChIKey | UVWSABPONSCSPF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|