C24H27N7O — CID 143368612
1-(2,4-dimethylphenyl)-4-methyl-5-(4-methylphenyl)-N-[3-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide (PubChem CID 143368612) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-4-methyl-5-(4-methylphenyl)-N-[3-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dimethylphenyl)-4-methyl-5-(4-methylphenyl)-N-[3-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 143368612 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-4-methyl-5-(4-methylphenyl)-N-[3-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-c2c(C)c(C(=O)NCCCc3nn[nH]n3)nn2-c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C24H27N7O/c1-15-7-10-19(11-8-15)23-18(4)22(24(32)25-13-5-6-21-26-29-30-27-21)28-31(23)20-12-9-16(2)14-17(20)3/h7-12,14H,5-6,13H2,1-4H3,(H,25,32)(H,26,27,29,30) |
| InChIKey | XJGNMDLZAHGWJG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|