C21H21ClN8O3S — CID 91066443
5-(4-chlorophenyl)-4-methyl-1-(3-sulfamoylphenyl)-N-[3-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide (PubChem CID 91066443) has the molecular formula C21H21ClN8O3S and a molecular weight of 500.97 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-methyl-1-(3-sulfamoylphenyl)-N-[3-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-4-methyl-1-(3-sulfamoylphenyl)-N-[3-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91066443 |
| Molecular Formula | C21H21ClN8O3S |
| Molecular Weight | 500.97 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 5-(4-chlorophenyl)-4-methyl-1-(3-sulfamoylphenyl)-N-[3-(2H-tetrazol-5-yl)propyl]pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCc2nn[nH]n2)nn(-c2cccc(S(N)(=O)=O)c2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN8O3S/c1-13-19(21(31)24-11-3-6-18-25-28-29-26-18)27-30(20(13)14-7-9-15(22)10-8-14)16-4-2-5-17(12-16)34(23,32)33/h2,4-5,7-10,12H,3,6,11H2,1H3,(H,24,31)(H2,23,32,33)(H,25,26,28,29) |
| InChIKey | NIIVPAITCRAURT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 161.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.97 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|