C24H26ClN3O3 — CID 24748077
5-[[1-(4-chloro-2-methylphenyl)-4-methyl-5-(4-methylphenyl)pyrazole-3-carbonyl]amino]pentanoic acid (PubChem CID 24748077) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is 5-[[1-(4-chloro-2-methylphenyl)-4-methyl-5-(4-methylphenyl)pyrazole-3-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[1-(4-chloro-2-methylphenyl)-4-methyl-5-(4-methylphenyl)pyrazole-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 24748077 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 5-[[1-(4-chloro-2-methylphenyl)-4-methyl-5-(4-methylphenyl)pyrazole-3-carbonyl]amino]pentanoic acid |
| SMILES | Cc1ccc(-c2c(C)c(C(=O)NCCCCC(=O)O)nn2-c2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-15-7-9-18(10-8-15)23-17(3)22(24(31)26-13-5-4-6-21(29)30)27-28(23)20-12-11-19(25)14-16(20)2/h7-12,14H,4-6,13H2,1-3H3,(H,26,31)(H,29,30) |
| InChIKey | HIPDFDKKYXBPEU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|