C13H15N3O5 — CID 28740247
3-[(2Z)-2-[1-(4-ethyl-3-nitrophenyl)ethylidene]hydrazinyl]-3-oxopropanoic acid (PubChem CID 28740247) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is 3-[(2Z)-2-[1-(4-ethyl-3-nitrophenyl)ethylidene]hydrazinyl]-3-oxopropanoic acid.
| Compound Name | 3-[(2Z)-2-[1-(4-ethyl-3-nitrophenyl)ethylidene]hydrazinyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 28740247 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 3-[(2Z)-2-[1-(4-ethyl-3-nitrophenyl)ethylidene]hydrazinyl]-3-oxopropanoic acid |
| SMILES | CCc1ccc(/C(C)=N\NC(=O)CC(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O5/c1-3-9-4-5-10(6-11(9)16(20)21)8(2)14-15-12(17)7-13(18)19/h4-6H,3,7H2,1-2H3,(H,15,17)(H,18,19)/b14-8- |
| InChIKey | OLMORZYUDBSYSQ-ZSOIEALJSA-N |
| XLogP | 1.47 |
| TPSA | 121.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|