C11H16N2O4 — CID 28746112
(E)-4-[(4-methylpiperidine-1-carbonyl)amino]-4-oxobut-2-enoic acid (PubChem CID 28746112) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (E)-4-[(4-methylpiperidine-1-carbonyl)amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(4-methylpiperidine-1-carbonyl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 28746112 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (E)-4-[(4-methylpiperidine-1-carbonyl)amino]-4-oxobut-2-enoic acid |
| SMILES | CC1CCN(C(=O)NC(=O)/C=C/C(=O)O)CC1 |
| InChI | InChI=1S/C11H16N2O4/c1-8-4-6-13(7-5-8)11(17)12-9(14)2-3-10(15)16/h2-3,8H,4-7H2,1H3,(H,15,16)(H,12,14,17)/b3-2+ |
| InChIKey | QGKBQTLAMZKNGD-NSCUHMNNSA-N |
| XLogP | 0.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|