C21H14FNO3S — CID 2875075
4-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one (PubChem CID 2875075) has the molecular formula C21H14FNO3S and a molecular weight of 379.41 g/mol. Its IUPAC name is 4-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one.
| Compound Name | 4-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 2875075 |
| Molecular Formula | C21H14FNO3S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 4-[[2-[(2-fluorophenyl)methoxy]phenyl]methylidene]-2-thiophen-2-yl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2cccs2)=NC1=Cc1ccccc1OCc1ccccc1F |
| InChI | InChI=1S/C21H14FNO3S/c22-16-8-3-1-7-15(16)13-25-18-9-4-2-6-14(18)12-17-21(24)26-20(23-17)19-10-5-11-27-19/h1-12H,13H2 |
| InChIKey | GPALROKKUPQWGD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|