C24H26Cl2N2O3S — CID 2876685
N-(1-adamantyl)-2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetamide (PubChem CID 2876685) has the molecular formula C24H26Cl2N2O3S and a molecular weight of 493.46 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetamide.
| Compound Name | N-(1-adamantyl)-2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetamide |
|---|---|
| PubChem CID | 2876685 |
| Molecular Formula | C24H26Cl2N2O3S |
| Molecular Weight | 493.46 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-(1-adamantyl)-2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H26Cl2N2O3S/c25-21-7-6-19(11-22(21)26)28(32(30,31)20-4-2-1-3-5-20)15-23(29)27-24-12-16-8-17(13-24)10-18(9-16)14-24/h1-7,11,16-18H,8-10,12-15H2,(H,27,29) |
| InChIKey | PDFPIPPFNDGBIV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |