C20H27N3O2 — CID 28768711
(3R,4R)-4-(4-hydroxypiperidin-1-yl)-1-(quinolin-4-ylmethyl)piperidin-3-ol (PubChem CID 28768711) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (3R,4R)-4-(4-hydroxypiperidin-1-yl)-1-(quinolin-4-ylmethyl)piperidin-3-ol.
| Compound Name | (3R,4R)-4-(4-hydroxypiperidin-1-yl)-1-(quinolin-4-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 28768711 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3R,4R)-4-(4-hydroxypiperidin-1-yl)-1-(quinolin-4-ylmethyl)piperidin-3-ol |
| SMILES | OC1CCN([C@@H]2CCN(Cc3ccnc4ccccc34)C[C@H]2O)CC1 |
| InChI | InChI=1S/C20H27N3O2/c24-16-6-11-23(12-7-16)19-8-10-22(14-20(19)25)13-15-5-9-21-18-4-2-1-3-17(15)18/h1-5,9,16,19-20,24-25H,6-8,10-14H2/t19-,20-/m1/s1 |
| InChIKey | VDINDKCBNWSMJR-WOJBJXKFSA-N |
| XLogP | 1.63 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |