C16H14N2O3 — CID 2876915
N-[furan-2-yl-(8-hydroxyquinolin-7-yl)methyl]acetamide (PubChem CID 2876915) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-[furan-2-yl-(8-hydroxyquinolin-7-yl)methyl]acetamide.
| Compound Name | N-[furan-2-yl-(8-hydroxyquinolin-7-yl)methyl]acetamide |
|---|---|
| PubChem CID | 2876915 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[furan-2-yl-(8-hydroxyquinolin-7-yl)methyl]acetamide |
| SMILES | CC(=O)NC(c1ccco1)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C16H14N2O3/c1-10(19)18-15(13-5-3-9-21-13)12-7-6-11-4-2-8-17-14(11)16(12)20/h2-9,15,20H,1H3,(H,18,19) |
| InChIKey | HEZNTDQCEKDWGC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|