C22H17ClN2O3 — CID 3144586
N-[(5-chloro-8-hydroxyquinolin-7-yl)-(furan-2-yl)methyl]-2-phenylacetamide (PubChem CID 3144586) has the molecular formula C22H17ClN2O3 and a molecular weight of 392.84 g/mol. Its IUPAC name is N-[(5-chloro-8-hydroxyquinolin-7-yl)-(furan-2-yl)methyl]-2-phenylacetamide.
| Compound Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-(furan-2-yl)methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 3144586 |
| Molecular Formula | C22H17ClN2O3 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N-[(5-chloro-8-hydroxyquinolin-7-yl)-(furan-2-yl)methyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(c1ccco1)c1cc(Cl)c2cccnc2c1O |
| InChI | InChI=1S/C22H17ClN2O3/c23-17-13-16(22(27)21-15(17)8-4-10-24-21)20(18-9-5-11-28-18)25-19(26)12-14-6-2-1-3-7-14/h1-11,13,20,27H,12H2,(H,25,26) |
| InChIKey | GEMUFCURVXNVJY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|