C13H22N2 — CID 28772740
N'-methyl-N'-(2-propan-2-ylphenyl)propane-1,3-diamine (PubChem CID 28772740) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N'-methyl-N'-(2-propan-2-ylphenyl)propane-1,3-diamine.
| Compound Name | N'-methyl-N'-(2-propan-2-ylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 28772740 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N'-methyl-N'-(2-propan-2-ylphenyl)propane-1,3-diamine |
| SMILES | CC(C)c1ccccc1N(C)CCCN |
| InChI | InChI=1S/C13H22N2/c1-11(2)12-7-4-5-8-13(12)15(3)10-6-9-14/h4-5,7-8,11H,6,9-10,14H2,1-3H3 |
| InChIKey | NVXMVYYXUSATBC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |