C10H12N2O2 — CID 28780453
N-(2-cyanoethyl)-N,5-dimethylfuran-2-carboxamide (PubChem CID 28780453) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N,5-dimethylfuran-2-carboxamide.
| Compound Name | N-(2-cyanoethyl)-N,5-dimethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 28780453 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N-(2-cyanoethyl)-N,5-dimethylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)CCC#N)o1 |
| InChI | InChI=1S/C10H12N2O2/c1-8-4-5-9(14-8)10(13)12(2)7-3-6-11/h4-5H,3,7H2,1-2H3 |
| InChIKey | WERGORYSIGQVAS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |