C11H10N2O5 — CID 28782613
4-methoxy-3-(1,2,4-oxadiazol-3-ylmethoxy)benzoic acid (PubChem CID 28782613) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 4-methoxy-3-(1,2,4-oxadiazol-3-ylmethoxy)benzoic acid.
| Compound Name | 4-methoxy-3-(1,2,4-oxadiazol-3-ylmethoxy)benzoic acid |
|---|---|
| PubChem CID | 28782613 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-methoxy-3-(1,2,4-oxadiazol-3-ylmethoxy)benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1OCc1ncon1 |
| InChI | InChI=1S/C11H10N2O5/c1-16-8-3-2-7(11(14)15)4-9(8)17-5-10-12-6-18-13-10/h2-4,6H,5H2,1H3,(H,14,15) |
| InChIKey | RJUNXIIXUOGOTF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |