C10H20N2O4S — CID 28783923
(2R)-4-methyl-2-(pyrrolidin-1-ylsulfonylazaniumyl)pentanoate (PubChem CID 28783923) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is (2R)-4-methyl-2-(pyrrolidin-1-ylsulfonylazaniumyl)pentanoate.
| Compound Name | (2R)-4-methyl-2-(pyrrolidin-1-ylsulfonylazaniumyl)pentanoate |
|---|---|
| PubChem CID | 28783923 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (2R)-4-methyl-2-(pyrrolidin-1-ylsulfonylazaniumyl)pentanoate |
| SMILES | CC(C)C[C@@H]([NH2+]S(=O)(=O)N1CCCC1)C(=O)[O-] |
| InChI | InChI=1S/C10H20N2O4S/c1-8(2)7-9(10(13)14)11-17(15,16)12-5-3-4-6-12/h8-9,11H,3-7H2,1-2H3,(H,13,14)/t9-/m1/s1 |
| InChIKey | SDWBFLYOGIREDL-SECBINFHSA-N |
| XLogP | -1.95 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |