C9H18N2O4S2 — CID 28783965
(2S)-4-methylsulfanyl-2-(pyrrolidin-1-ylsulfonylazaniumyl)butanoate (PubChem CID 28783965) has the molecular formula C9H18N2O4S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-(pyrrolidin-1-ylsulfonylazaniumyl)butanoate.
| Compound Name | (2S)-4-methylsulfanyl-2-(pyrrolidin-1-ylsulfonylazaniumyl)butanoate |
|---|---|
| PubChem CID | 28783965 |
| Molecular Formula | C9H18N2O4S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-(pyrrolidin-1-ylsulfonylazaniumyl)butanoate |
| SMILES | CSCC[C@H]([NH2+]S(=O)(=O)N1CCCC1)C(=O)[O-] |
| InChI | InChI=1S/C9H18N2O4S2/c1-16-7-4-8(9(12)13)10-17(14,15)11-5-2-3-6-11/h8,10H,2-7H2,1H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | SHOHLDOVHLDAGI-QMMMGPOBSA-N |
| XLogP | -2.24 |
| TPSA | 94.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |