C17H23N2O5S2- — CID 8022622
(2S)-2-[[(3R)-1-(benzenesulfonyl)piperidine-3-carbonyl]amino]-4-methylsulfanylbutanoate (PubChem CID 8022622) has the molecular formula C17H23N2O5S2- and a molecular weight of 399.51 g/mol. Its IUPAC name is (2S)-2-[[(3R)-1-(benzenesulfonyl)piperidine-3-carbonyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[[(3R)-1-(benzenesulfonyl)piperidine-3-carbonyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 8022622 |
| Molecular Formula | C17H23N2O5S2- |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (2S)-2-[[(3R)-1-(benzenesulfonyl)piperidine-3-carbonyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1CCCN(S(=O)(=O)c2ccccc2)C1)C(=O)[O-] |
| InChI | InChI=1S/C17H24N2O5S2/c1-25-11-9-15(17(21)22)18-16(20)13-6-5-10-19(12-13)26(23,24)14-7-3-2-4-8-14/h2-4,7-8,13,15H,5-6,9-12H2,1H3,(H,18,20)(H,21,22)/p-1/t13-,15+/m1/s1 |
| InChIKey | KJAUHRBJVONLAM-HIFRSBDPSA-M |
| XLogP | 0.08 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |