C18H30N4OS — CID 28784303
(3R,4R)-1-(3-methylsulfanylpropyl)-4-(4-pyridin-2-ylpiperazin-1-yl)piperidin-3-ol (PubChem CID 28784303) has the molecular formula C18H30N4OS and a molecular weight of 350.53 g/mol. Its IUPAC name is (3R,4R)-1-(3-methylsulfanylpropyl)-4-(4-pyridin-2-ylpiperazin-1-yl)piperidin-3-ol.
| Compound Name | (3R,4R)-1-(3-methylsulfanylpropyl)-4-(4-pyridin-2-ylpiperazin-1-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 28784303 |
| Molecular Formula | C18H30N4OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (3R,4R)-1-(3-methylsulfanylpropyl)-4-(4-pyridin-2-ylpiperazin-1-yl)piperidin-3-ol |
| SMILES | CSCCCN1CC[C@@H](N2CCN(c3ccccn3)CC2)[C@H](O)C1 |
| InChI | InChI=1S/C18H30N4OS/c1-24-14-4-8-20-9-6-16(17(23)15-20)21-10-12-22(13-11-21)18-5-2-3-7-19-18/h2-3,5,7,16-17,23H,4,6,8-15H2,1H3/t16-,17-/m1/s1 |
| InChIKey | ZQUHQPDEKKNHHM-IAGOWNOFSA-N |
| XLogP | 1.39 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|