C10H19N3O2S — CID 28785073
N-(2-cyanoethyl)-N,4-dimethylpiperidine-1-sulfonamide (PubChem CID 28785073) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N,4-dimethylpiperidine-1-sulfonamide.
| Compound Name | N-(2-cyanoethyl)-N,4-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 28785073 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-(2-cyanoethyl)-N,4-dimethylpiperidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)N(C)CCC#N)CC1 |
| InChI | InChI=1S/C10H19N3O2S/c1-10-4-8-13(9-5-10)16(14,15)12(2)7-3-6-11/h10H,3-5,7-9H2,1-2H3 |
| InChIKey | WNRZEYNPFIQAOG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |