C11H17N3O2S2 — CID 28785092
2-(diethylsulfamoylamino)benzenecarbothioamide (PubChem CID 28785092) has the molecular formula C11H17N3O2S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(diethylsulfamoylamino)benzenecarbothioamide.
| Compound Name | 2-(diethylsulfamoylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 28785092 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 2-(diethylsulfamoylamino)benzenecarbothioamide |
| SMILES | CCN(CC)S(=O)(=O)Nc1ccccc1C(N)=S |
| InChI | InChI=1S/C11H17N3O2S2/c1-3-14(4-2)18(15,16)13-10-8-6-5-7-9(10)11(12)17/h5-8,13H,3-4H2,1-2H3,(H2,12,17) |
| InChIKey | JBEGLILPFXJILM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|