C13H13N5O4 — CID 2878758
2-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)-N-[(3-nitrophenyl)methylideneamino]acetamide (PubChem CID 2878758) has the molecular formula C13H13N5O4 and a molecular weight of 303.28 g/mol. Its IUPAC name is 2-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)-N-[(3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)-N-[(3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2878758 |
| Molecular Formula | C13H13N5O4 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(3-methyl-5-oxo-1,4-dihydropyrazol-4-yl)-N-[(3-nitrophenyl)methylideneamino]acetamide |
| SMILES | CC1=NNC(=O)C1CC(=O)NN=Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13N5O4/c1-8-11(13(20)17-15-8)6-12(19)16-14-7-9-3-2-4-10(5-9)18(21)22/h2-5,7,11H,6H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | JKCDGBOIXHVZJB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|