C10H15N3O4 — CID 28788693
6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]hexanoic acid (PubChem CID 28788693) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]hexanoic acid.
| Compound Name | 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 28788693 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N3O4/c14-8(15)4-2-1-3-5-11-9(16)7-6-12-10(17)13-7/h6H,1-5H2,(H,11,16)(H,14,15)(H2,12,13,17) |
| InChIKey | FAAUKUPQDUYMEW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|