C11H14N3O5- — CID 7298450
6-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]hexanoate (PubChem CID 7298450) has the molecular formula C11H14N3O5- and a molecular weight of 268.25 g/mol. Its IUPAC name is 6-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]hexanoate.
| Compound Name | 6-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 7298450 |
| Molecular Formula | C11H14N3O5- |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 6-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]hexanoate |
| SMILES | O=C([O-])CCCCCNC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N3O5/c15-8-6-7(13-11(19)14-8)10(18)12-5-3-1-2-4-9(16)17/h6H,1-5H2,(H,12,18)(H,16,17)(H2,13,14,15,19)/p-1 |
| InChIKey | JENYBQGBHAJBST-UHFFFAOYSA-M |
| XLogP | -1.90 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|