6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid

C12H17N3O5 — CID 43352934

IUPAC6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid
SMILESO=C(O)CCCCCNC(=O)Cn1ccc(=O)[nH]c1=O
InChIInChI=1S/C12H17N3O5/c16-9-5-7-15(12(20)14-9)8-10(17)13-6-3-1-2-4-11(18)19/h5,7H,1-4,6,8H2,(H,13,17)(H,18,19)(H,14,16,20)
InChIKeyNBGKLNCAZZYEED-UHFFFAOYSA-N
MW283.28 g/mol
LogP-0.70
Rot. Bonds8

About 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid

6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid (PubChem CID 43352934) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid.

Molecular Properties

Compound Name6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid
PubChem CID43352934
Molecular FormulaC12H17N3O5
Molecular Weight283.28 g/mol
Exact Mass283.12
IUPAC Name6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid
SMILESO=C(O)CCCCCNC(=O)Cn1ccc(=O)[nH]c1=O
InChIInChI=1S/C12H17N3O5/c16-9-5-7-15(12(20)14-9)8-10(17)13-6-3-1-2-4-11(18)19/h5,7H,1-4,6,8H2,(H,13,17)(H,18,19)(H,14,16,20)
InChIKeyNBGKLNCAZZYEED-UHFFFAOYSA-N
XLogP-0.70
TPSA121.26 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.28
LogP ≤ 5-0.70
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid?
The IUPAC name of 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid (CID 43352934) is 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid.
What is the SMILES notation for 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid?
The canonical SMILES for 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid is O=C(O)CCCCCNC(=O)Cn1ccc(=O)[nH]c1=O.
What is the InChIKey of 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid?
The InChIKey is NBGKLNCAZZYEED-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O5/c16-9-5-7-15(12(20)14-9)8-10(17)13-6-3-1-2-4-11(18)19/h5,7H,1-4,6,8H2,(H,13,17)(H,18,19)(H,14,16,20).
What are the key properties of 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid?
6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid has a molecular weight of 283.28 g/mol, XLogP of -0.70, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]hexanoic acid is sourced from PubChem (CID 43352934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).