C18H29N5O6 — CID 23225826
6-[3-[2-aminoethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoylamino]hexanoic acid (PubChem CID 23225826) has the molecular formula C18H29N5O6 and a molecular weight of 411.46 g/mol. Its IUPAC name is 6-[3-[2-aminoethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-[3-[2-aminoethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 23225826 |
| Molecular Formula | C18H29N5O6 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 6-[3-[2-aminoethyl-[2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetyl]amino]propanoylamino]hexanoic acid |
| SMILES | Cc1cn(CC(=O)N(CCN)CCC(=O)NCCCCCC(=O)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H29N5O6/c1-13-11-23(18(29)21-17(13)28)12-15(25)22(10-7-19)9-6-14(24)20-8-4-2-3-5-16(26)27/h11H,2-10,12,19H2,1H3,(H,20,24)(H,26,27)(H,21,28,29) |
| InChIKey | OSFBIGWDRXCQIH-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 167.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|