C11H15N3O5 — CID 43469900
2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoic acid (PubChem CID 43469900) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoic acid.
| Compound Name | 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 43469900 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)c1c[nH]c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C11H15N3O5/c1-2-3-4-7(10(17)18)13-8(15)6-5-12-11(19)14-9(6)16/h5,7H,2-4H2,1H3,(H,13,15)(H,17,18)(H2,12,14,16,19) |
| InChIKey | WJXGSWZEWCMACT-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |