C10H14N2O5 — CID 54020445
6-(6-hydroxy-2,4-dioxopyrimidin-1-yl)hexanoic acid (PubChem CID 54020445) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 6-(6-hydroxy-2,4-dioxopyrimidin-1-yl)hexanoic acid.
| Compound Name | 6-(6-hydroxy-2,4-dioxopyrimidin-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 54020445 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 6-(6-hydroxy-2,4-dioxopyrimidin-1-yl)hexanoic acid |
| SMILES | O=C(O)CCCCCn1c(O)cc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N2O5/c13-7-6-8(14)12(10(17)11-7)5-3-1-2-4-9(15)16/h6,14H,1-5H2,(H,15,16)(H,11,13,17) |
| InChIKey | KYOCGXQDPKMNFO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|