C9H10N4O5 — CID 28790272
(2R)-4-amino-4-oxo-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]butanoic acid (PubChem CID 28790272) has the molecular formula C9H10N4O5 and a molecular weight of 254.20 g/mol. Its IUPAC name is (2R)-4-amino-4-oxo-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]butanoic acid.
| Compound Name | (2R)-4-amino-4-oxo-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 28790272 |
| Molecular Formula | C9H10N4O5 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (2R)-4-amino-4-oxo-2-[(6-oxo-1H-pyrazine-3-carbonyl)amino]butanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)c1c[nH]c(=O)cn1)C(=O)O |
| InChI | InChI=1S/C9H10N4O5/c10-6(14)1-4(9(17)18)13-8(16)5-2-12-7(15)3-11-5/h2-4H,1H2,(H2,10,14)(H,12,15)(H,13,16)(H,17,18)/t4-/m1/s1 |
| InChIKey | CLWFBVULOMFWEW-SCSAIBSYSA-N |
| XLogP | -2.17 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |