C10H12F2N2O — CID 28794968
2-amino-N-(3,4-difluorophenyl)-N-ethylacetamide (PubChem CID 28794968) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-amino-N-(3,4-difluorophenyl)-N-ethylacetamide.
| Compound Name | 2-amino-N-(3,4-difluorophenyl)-N-ethylacetamide |
|---|---|
| PubChem CID | 28794968 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-amino-N-(3,4-difluorophenyl)-N-ethylacetamide |
| SMILES | CCN(C(=O)CN)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2O/c1-2-14(10(15)6-13)7-3-4-8(11)9(12)5-7/h3-5H,2,6,13H2,1H3 |
| InChIKey | JEGARAKPXQGORT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |