C17H17F2NO — CID 55592767
N-(3,4-difluorophenyl)-N-ethyl-2-(4-methylphenyl)acetamide (PubChem CID 55592767) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N-ethyl-2-(4-methylphenyl)acetamide.
| Compound Name | N-(3,4-difluorophenyl)-N-ethyl-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 55592767 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-(3,4-difluorophenyl)-N-ethyl-2-(4-methylphenyl)acetamide |
| SMILES | CCN(C(=O)Cc1ccc(C)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H17F2NO/c1-3-20(14-8-9-15(18)16(19)11-14)17(21)10-13-6-4-12(2)5-7-13/h4-9,11H,3,10H2,1-2H3 |
| InChIKey | OCPPIQPSSRXNEK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |