C26H23N3O — CID 2879517
6-(4-methylphenyl)-5,7-diphenyl-1,2,3,6-tetrahydropyrrolo[3,4-e][1,4]diazepin-8-one (PubChem CID 2879517) has the molecular formula C26H23N3O and a molecular weight of 393.49 g/mol. Its IUPAC name is 6-(4-methylphenyl)-5,7-diphenyl-1,2,3,6-tetrahydropyrrolo[3,4-e][1,4]diazepin-8-one.
| Compound Name | 6-(4-methylphenyl)-5,7-diphenyl-1,2,3,6-tetrahydropyrrolo[3,4-e][1,4]diazepin-8-one |
|---|---|
| PubChem CID | 2879517 |
| Molecular Formula | C26H23N3O |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 6-(4-methylphenyl)-5,7-diphenyl-1,2,3,6-tetrahydropyrrolo[3,4-e][1,4]diazepin-8-one |
| SMILES | Cc1ccc(C2C3=C(NCCN=C3c3ccccc3)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O/c1-18-12-14-20(15-13-18)25-22-23(19-8-4-2-5-9-19)27-16-17-28-24(22)26(30)29(25)21-10-6-3-7-11-21/h2-15,25,28H,16-17H2,1H3 |
| InChIKey | PSIIUYQKJREXOJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |