C11H6Cl2N2O3 — CID 28799456
4-(3,4-dichlorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid (PubChem CID 28799456) has the molecular formula C11H6Cl2N2O3 and a molecular weight of 285.09 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid.
| Compound Name | 4-(3,4-dichlorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 28799456 |
| Molecular Formula | C11H6Cl2N2O3 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-oxo-1H-pyrimidine-6-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(Cl)c(Cl)c2)nc(=O)[nH]1 |
| InChI | InChI=1S/C11H6Cl2N2O3/c12-6-2-1-5(3-7(6)13)8-4-9(10(16)17)15-11(18)14-8/h1-4H,(H,16,17)(H,14,15,18) |
| InChIKey | HWRUUTHVTPWMEV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |