C20H26N4S — CID 28809780
(3R)-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)-1-[(E)-3-phenylprop-2-enyl]piperidine (PubChem CID 28809780) has the molecular formula C20H26N4S and a molecular weight of 354.52 g/mol. Its IUPAC name is (3R)-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)-1-[(E)-3-phenylprop-2-enyl]piperidine.
| Compound Name | (3R)-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)-1-[(E)-3-phenylprop-2-enyl]piperidine |
|---|---|
| PubChem CID | 28809780 |
| Molecular Formula | C20H26N4S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (3R)-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)-1-[(E)-3-phenylprop-2-enyl]piperidine |
| SMILES | C=CCSc1nnc([C@@H]2CCCN(C/C=C/c3ccccc3)C2)n1C |
| InChI | InChI=1S/C20H26N4S/c1-3-15-25-20-22-21-19(23(20)2)18-12-8-14-24(16-18)13-7-11-17-9-5-4-6-10-17/h3-7,9-11,18H,1,8,12-16H2,2H3/b11-7+/t18-/m1/s1 |
| InChIKey | LBUPVWHKPAHXPX-JGZYNSJSSA-N |
| XLogP | 3.99 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|