C19H26N4O2S — CID 125179004
2-methoxy-4-[[(3R)-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)piperidin-1-yl]methyl]phenol (PubChem CID 125179004) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-methoxy-4-[[(3R)-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-4-[[(3R)-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 125179004 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-methoxy-4-[[(3R)-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)piperidin-1-yl]methyl]phenol |
| SMILES | C=CCSc1nnc([C@@H]2CCCN(Cc3ccc(O)c(OC)c3)C2)n1C |
| InChI | InChI=1S/C19H26N4O2S/c1-4-10-26-19-21-20-18(22(19)2)15-6-5-9-23(13-15)12-14-7-8-16(24)17(11-14)25-3/h4,7-8,11,15,24H,1,5-6,9-10,12-13H2,2-3H3/t15-/m1/s1 |
| InChIKey | XYENKTJBOLUKCR-OAHLLOKOSA-N |
| XLogP | 3.19 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|