C16H21N3O4S2 — CID 92594217
2-methoxy-4-[[(3S)-3-(5-methylsulfonylthiadiazol-4-yl)piperidin-1-yl]methyl]phenol (PubChem CID 92594217) has the molecular formula C16H21N3O4S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-methoxy-4-[[(3S)-3-(5-methylsulfonylthiadiazol-4-yl)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-methoxy-4-[[(3S)-3-(5-methylsulfonylthiadiazol-4-yl)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 92594217 |
| Molecular Formula | C16H21N3O4S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-methoxy-4-[[(3S)-3-(5-methylsulfonylthiadiazol-4-yl)piperidin-1-yl]methyl]phenol |
| SMILES | COc1cc(CN2CCC[C@H](c3nnsc3S(C)(=O)=O)C2)ccc1O |
| InChI | InChI=1S/C16H21N3O4S2/c1-23-14-8-11(5-6-13(14)20)9-19-7-3-4-12(10-19)15-16(24-18-17-15)25(2,21)22/h5-6,8,12,20H,3-4,7,9-10H2,1-2H3/t12-/m0/s1 |
| InChIKey | YVUBANUZDFMLAO-LBPRGKRZSA-N |
| XLogP | 2.04 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |