C14H18N4O2S2 — CID 110237132
5-methylsulfonyl-4-[1-(pyridin-2-ylmethyl)piperidin-3-yl]thiadiazole (PubChem CID 110237132) has the molecular formula C14H18N4O2S2 and a molecular weight of 338.46 g/mol. Its IUPAC name is 5-methylsulfonyl-4-[1-(pyridin-2-ylmethyl)piperidin-3-yl]thiadiazole.
| Compound Name | 5-methylsulfonyl-4-[1-(pyridin-2-ylmethyl)piperidin-3-yl]thiadiazole |
|---|---|
| PubChem CID | 110237132 |
| Molecular Formula | C14H18N4O2S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 5-methylsulfonyl-4-[1-(pyridin-2-ylmethyl)piperidin-3-yl]thiadiazole |
| SMILES | CS(=O)(=O)c1snnc1C1CCCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C14H18N4O2S2/c1-22(19,20)14-13(16-17-21-14)11-5-4-8-18(9-11)10-12-6-2-3-7-15-12/h2-3,6-7,11H,4-5,8-10H2,1H3 |
| InChIKey | COVOHNJTBUTQLH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |