C12H17N5O2S2 — CID 110237156
4-[1-(1H-imidazol-2-ylmethyl)piperidin-3-yl]-5-methylsulfonylthiadiazole (PubChem CID 110237156) has the molecular formula C12H17N5O2S2 and a molecular weight of 327.44 g/mol. Its IUPAC name is 4-[1-(1H-imidazol-2-ylmethyl)piperidin-3-yl]-5-methylsulfonylthiadiazole.
| Compound Name | 4-[1-(1H-imidazol-2-ylmethyl)piperidin-3-yl]-5-methylsulfonylthiadiazole |
|---|---|
| PubChem CID | 110237156 |
| Molecular Formula | C12H17N5O2S2 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-[1-(1H-imidazol-2-ylmethyl)piperidin-3-yl]-5-methylsulfonylthiadiazole |
| SMILES | CS(=O)(=O)c1snnc1C1CCCN(Cc2ncc[nH]2)C1 |
| InChI | InChI=1S/C12H17N5O2S2/c1-21(18,19)12-11(15-16-20-12)9-3-2-6-17(7-9)8-10-13-4-5-14-10/h4-5,9H,2-3,6-8H2,1H3,(H,13,14) |
| InChIKey | RFILROUYJAMUQM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |