C15H19N3O3S2 — CID 110237125
2-[[3-(5-methylsulfonylthiadiazol-4-yl)piperidin-1-yl]methyl]phenol (PubChem CID 110237125) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[[3-(5-methylsulfonylthiadiazol-4-yl)piperidin-1-yl]methyl]phenol.
| Compound Name | 2-[[3-(5-methylsulfonylthiadiazol-4-yl)piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 110237125 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[[3-(5-methylsulfonylthiadiazol-4-yl)piperidin-1-yl]methyl]phenol |
| SMILES | CS(=O)(=O)c1snnc1C1CCCN(Cc2ccccc2O)C1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-23(20,21)15-14(16-17-22-15)12-6-4-8-18(10-12)9-11-5-2-3-7-13(11)19/h2-3,5,7,12,19H,4,6,8-10H2,1H3 |
| InChIKey | QIRCXVARUCWWIY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|