C19H19N3O5S2 — CID 110237178
6-methyl-2-[3-(5-methylsulfonylthiadiazol-4-yl)piperidine-1-carbonyl]chromen-4-one (PubChem CID 110237178) has the molecular formula C19H19N3O5S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 6-methyl-2-[3-(5-methylsulfonylthiadiazol-4-yl)piperidine-1-carbonyl]chromen-4-one.
| Compound Name | 6-methyl-2-[3-(5-methylsulfonylthiadiazol-4-yl)piperidine-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 110237178 |
| Molecular Formula | C19H19N3O5S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 6-methyl-2-[3-(5-methylsulfonylthiadiazol-4-yl)piperidine-1-carbonyl]chromen-4-one |
| SMILES | Cc1ccc2oc(C(=O)N3CCCC(c4nnsc4S(C)(=O)=O)C3)cc(=O)c2c1 |
| InChI | InChI=1S/C19H19N3O5S2/c1-11-5-6-15-13(8-11)14(23)9-16(27-15)18(24)22-7-3-4-12(10-22)17-19(28-21-20-17)29(2,25)26/h5-6,8-9,12H,3-4,7,10H2,1-2H3 |
| InChIKey | RTDREKNETRVLBR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 110.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |