C16H18N2O5S — CID 125174116
[(3R)-1-(7-methyl-4-oxochromene-2-carbonyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 125174116) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is [(3R)-1-(7-methyl-4-oxochromene-2-carbonyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [(3R)-1-(7-methyl-4-oxochromene-2-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 125174116 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [(3R)-1-(7-methyl-4-oxochromene-2-carbonyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | Cc1ccc2c(=O)cc(C(=O)N3CC[C@@H](CS(N)(=O)=O)C3)oc2c1 |
| InChI | InChI=1S/C16H18N2O5S/c1-10-2-3-12-13(19)7-15(23-14(12)6-10)16(20)18-5-4-11(8-18)9-24(17,21)22/h2-3,6-7,11H,4-5,8-9H2,1H3,(H2,17,21,22)/t11-/m1/s1 |
| InChIKey | GZDZCIDSCLIYSM-LLVKDONJSA-N |
| XLogP | 0.85 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |