C20H28N4O2S — CID 45218868
1-[(2,3-dimethoxyphenyl)methyl]-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)piperidine (PubChem CID 45218868) has the molecular formula C20H28N4O2S and a molecular weight of 388.54 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)methyl]-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)piperidine.
| Compound Name | 1-[(2,3-dimethoxyphenyl)methyl]-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)piperidine |
|---|---|
| PubChem CID | 45218868 |
| Molecular Formula | C20H28N4O2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)methyl]-3-(4-methyl-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl)piperidine |
| SMILES | C=CCSc1nnc(C2CCCN(Cc3cccc(OC)c3OC)C2)n1C |
| InChI | InChI=1S/C20H28N4O2S/c1-5-12-27-20-22-21-19(23(20)2)16-9-7-11-24(14-16)13-15-8-6-10-17(25-3)18(15)26-4/h5-6,8,10,16H,1,7,9,11-14H2,2-4H3 |
| InChIKey | JDLMQALNAFVHPR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|