C19H38ClNO2 — CID 2882591
1-(4-tert-butylcyclohexyl)oxy-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride (PubChem CID 2882591) has the molecular formula C19H38ClNO2 and a molecular weight of 347.97 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexyl)oxy-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride.
| Compound Name | 1-(4-tert-butylcyclohexyl)oxy-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 2882591 |
| Molecular Formula | C19H38ClNO2 |
| Molecular Weight | 347.97 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1-(4-tert-butylcyclohexyl)oxy-3-(4-methylpiperidin-1-yl)propan-2-ol;hydrochloride |
| SMILES | CC1CCN(CC(O)COC2CCC(C(C)(C)C)CC2)CC1.Cl |
| InChI | InChI=1S/C19H37NO2.ClH/c1-15-9-11-20(12-10-15)13-17(21)14-22-18-7-5-16(6-8-18)19(2,3)4;/h15-18,21H,5-14H2,1-4H3;1H |
| InChIKey | OPHUJENUIAFJPF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.97 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |