C22H22ClN3O6 — CID 28836200
(5S)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 28836200) has the molecular formula C22H22ClN3O6 and a molecular weight of 459.89 g/mol. Its IUPAC name is (5S)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 28836200 |
| Molecular Formula | C22H22ClN3O6 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (5S)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | CN(C)CCCN1C(=O)C(=O)C(=C(O)c2cc(Cl)ccc2O)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22ClN3O6/c1-24(2)9-4-10-25-19(13-5-3-6-15(11-13)26(31)32)18(21(29)22(25)30)20(28)16-12-14(23)7-8-17(16)27/h3,5-8,11-12,19,27-28H,4,9-10H2,1-2H3/t19-/m0/s1 |
| InChIKey | WWBVDFDTIHFVBO-IBGZPJMESA-N |
| XLogP | 3.33 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|