C20H21ClN2O4S — CID 28836634
(5S)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-thiophen-2-ylpyrrolidine-2,3-dione (PubChem CID 28836634) has the molecular formula C20H21ClN2O4S and a molecular weight of 420.92 g/mol. Its IUPAC name is (5S)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-thiophen-2-ylpyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-thiophen-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 28836634 |
| Molecular Formula | C20H21ClN2O4S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (5S)-4-[(5-chloro-2-hydroxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-thiophen-2-ylpyrrolidine-2,3-dione |
| SMILES | CN(C)CCCN1C(=O)C(=O)C(=C(O)c2cc(Cl)ccc2O)[C@H]1c1cccs1 |
| InChI | InChI=1S/C20H21ClN2O4S/c1-22(2)8-4-9-23-17(15-5-3-10-28-15)16(19(26)20(23)27)18(25)13-11-12(21)6-7-14(13)24/h3,5-7,10-11,17,24-25H,4,8-9H2,1-2H3/t17-/m1/s1 |
| InChIKey | MCVDDCNRXQTWAY-QGZVFWFLSA-N |
| XLogP | 3.48 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|