C27H34N2O5 — CID 28838610
(5R)-1-[3-(diethylamino)propyl]-5-(3-ethoxyphenyl)-4-[hydroxy-(2-hydroxy-5-methylphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 28838610) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is (5R)-1-[3-(diethylamino)propyl]-5-(3-ethoxyphenyl)-4-[hydroxy-(2-hydroxy-5-methylphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-[3-(diethylamino)propyl]-5-(3-ethoxyphenyl)-4-[hydroxy-(2-hydroxy-5-methylphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 28838610 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (5R)-1-[3-(diethylamino)propyl]-5-(3-ethoxyphenyl)-4-[hydroxy-(2-hydroxy-5-methylphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cccc([C@@H]2C(=C(O)c3cc(C)ccc3O)C(=O)C(=O)N2CCCN(CC)CC)c1 |
| InChI | InChI=1S/C27H34N2O5/c1-5-28(6-2)14-9-15-29-24(19-10-8-11-20(17-19)34-7-3)23(26(32)27(29)33)25(31)21-16-18(4)12-13-22(21)30/h8,10-13,16-17,24,30-31H,5-7,9,14-15H2,1-4H3/t24-/m1/s1 |
| InChIKey | NSIDSMRCVIQPJE-XMMPIXPASA-N |
| XLogP | 4.25 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|