C15H22N2O3 — CID 28839488
(2R)-2-(2-methoxyphenoxy)-1-(4-methylpiperazin-1-yl)propan-1-one (PubChem CID 28839488) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2R)-2-(2-methoxyphenoxy)-1-(4-methylpiperazin-1-yl)propan-1-one.
| Compound Name | (2R)-2-(2-methoxyphenoxy)-1-(4-methylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 28839488 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (2R)-2-(2-methoxyphenoxy)-1-(4-methylpiperazin-1-yl)propan-1-one |
| SMILES | COc1ccccc1O[C@H](C)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C15H22N2O3/c1-12(15(18)17-10-8-16(2)9-11-17)20-14-7-5-4-6-13(14)19-3/h4-7,12H,8-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | NGMYSDHBAZMJRA-GFCCVEGCSA-N |
| XLogP | 1.24 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |