C16H24N2O3 — CID 9181761
(2R)-1-(4-ethylpiperazin-1-yl)-2-(2-methoxyphenoxy)propan-1-one (PubChem CID 9181761) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2R)-1-(4-ethylpiperazin-1-yl)-2-(2-methoxyphenoxy)propan-1-one.
| Compound Name | (2R)-1-(4-ethylpiperazin-1-yl)-2-(2-methoxyphenoxy)propan-1-one |
|---|---|
| PubChem CID | 9181761 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2R)-1-(4-ethylpiperazin-1-yl)-2-(2-methoxyphenoxy)propan-1-one |
| SMILES | CCN1CCN(C(=O)[C@@H](C)Oc2ccccc2OC)CC1 |
| InChI | InChI=1S/C16H24N2O3/c1-4-17-9-11-18(12-10-17)16(19)13(2)21-15-8-6-5-7-14(15)20-3/h5-8,13H,4,9-12H2,1-3H3/t13-/m1/s1 |
| InChIKey | RKKZXZJYVWJWMR-CYBMUJFWSA-N |
| XLogP | 1.63 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |