C21H23Cl2F3N4O — CID 2884677
[3-chloro-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone (PubChem CID 2884677) has the molecular formula C21H23Cl2F3N4O and a molecular weight of 475.34 g/mol. Its IUPAC name is [3-chloro-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone.
| Compound Name | [3-chloro-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 2884677 |
| Molecular Formula | C21H23Cl2F3N4O |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [3-chloro-5-(4-chlorophenyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-2-yl]-(2,6-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CCCC(C)N1C(=O)c1nn2c(c1Cl)NC(c1ccc(Cl)cc1)CC2C(F)(F)F |
| InChI | InChI=1S/C21H23Cl2F3N4O/c1-11-4-3-5-12(2)29(11)20(31)18-17(23)19-27-15(13-6-8-14(22)9-7-13)10-16(21(24,25)26)30(19)28-18/h6-9,11-12,15-16,27H,3-5,10H2,1-2H3 |
| InChIKey | WXZKGKOOZBXROH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |