C14H20N6O2 — CID 28854477
[1-[[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]methyl]triazol-4-yl]methanol (PubChem CID 28854477) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is [1-[[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]methyl]triazol-4-yl]methanol.
| Compound Name | [1-[[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 28854477 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | [1-[[1-(6-methoxypyrimidin-4-yl)piperidin-4-yl]methyl]triazol-4-yl]methanol |
| SMILES | COc1cc(N2CCC(Cn3cc(CO)nn3)CC2)ncn1 |
| InChI | InChI=1S/C14H20N6O2/c1-22-14-6-13(15-10-16-14)19-4-2-11(3-5-19)7-20-8-12(9-21)17-18-20/h6,8,10-11,21H,2-5,7,9H2,1H3 |
| InChIKey | CSBIJOVTEPGCDF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |