C16H12ClFN2OS — CID 28856570
4-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-1,3-thiazol-2-amine (PubChem CID 28856570) has the molecular formula C16H12ClFN2OS and a molecular weight of 334.80 g/mol. Its IUPAC name is 4-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 28856570 |
| Molecular Formula | C16H12ClFN2OS |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccc(OCc3c(F)cccc3Cl)cc2)cs1 |
| InChI | InChI=1S/C16H12ClFN2OS/c17-13-2-1-3-14(18)12(13)8-21-11-6-4-10(5-7-11)15-9-22-16(19)20-15/h1-7,9H,8H2,(H2,19,20) |
| InChIKey | FSWDULXPAAMXDY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |